C19H27BrO6 — CID 70479882
(1R)-1-[(3aR,5R,6S,6aR)-6-[(4-bromo-2-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]butan-1-ol (PubChem CID 70479882) has the molecular formula C19H27BrO6 and a molecular weight of 431.32 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-6-[(4-bromo-2-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]butan-1-ol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(4-bromo-2-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]butan-1-ol |
|---|---|
| PubChem CID | 70479882 |
| Molecular Formula | C19H27BrO6 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-6-[(4-bromo-2-methoxyphenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]butan-1-ol |
| SMILES | CCC[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccc(Br)cc1OC |
| InChI | InChI=1S/C19H27BrO6/c1-5-6-13(21)15-16(17-18(24-15)26-19(2,3)25-17)23-10-11-7-8-12(20)9-14(11)22-4/h7-9,13,15-18,21H,5-6,10H2,1-4H3/t13-,15-,16+,17-,18-/m1/s1 |
| InChIKey | KCIDKSLOXZMVBR-SOVHRIKKSA-N |
| XLogP | 3.38 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |