C11H14Cl2N+ — CID 7048050
(2R)-2-(2,3-dichlorophenyl)piperidin-1-ium (PubChem CID 7048050) has the molecular formula C11H14Cl2N+ and a molecular weight of 231.15 g/mol. Its IUPAC name is (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium.
| Compound Name | (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium |
|---|---|
| PubChem CID | 7048050 |
| Molecular Formula | C11H14Cl2N+ |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium |
| SMILES | Clc1cccc([C@H]2CCCC[NH2+]2)c1Cl |
| InChI | InChI=1S/C11H13Cl2N/c12-9-5-3-4-8(11(9)13)10-6-1-2-7-14-10/h3-5,10,14H,1-2,6-7H2/p+1/t10-/m1/s1 |
| InChIKey | SVTIFKIPTUYJLE-SNVBAGLBSA-O |
| XLogP | 2.78 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |