About (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium
(2R)-2-(2,3-dichlorophenyl)piperidin-1-ium (PubChem CID 7048050) has the molecular formula C11H14Cl2N+
and a molecular weight of 231.15 g/mol. Its IUPAC name is (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium.
Molecular Properties
| Compound Name | (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium |
| PubChem CID | 7048050 |
| Molecular Formula | C11H14Cl2N+ |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium |
| SMILES | Clc1cccc([C@H]2CCCC[NH2+]2)c1Cl |
| InChI | InChI=1S/C11H13Cl2N/c12-9-5-3-4-8(11(9)13)10-6-1-2-7-14-10/h3-5,10,14H,1-2,6-7H2/p+1/t10-/m1/s1 |
| InChIKey | SVTIFKIPTUYJLE-SNVBAGLBSA-O |
| XLogP | 2.78 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium?
The IUPAC name of (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium (CID 7048050) is (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium.
What is the SMILES notation for (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium?
The canonical SMILES for (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium is Clc1cccc([C@H]2CCCC[NH2+]2)c1Cl.
What is the InChIKey of (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium?
The InChIKey is SVTIFKIPTUYJLE-SNVBAGLBSA-O. The full InChI is InChI=1S/C11H13Cl2N/c12-9-5-3-4-8(11(9)13)10-6-1-2-7-14-10/h3-5,10,14H,1-2,6-7H2/p+1/t10-/m1/s1.
What are the key properties of (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium?
(2R)-2-(2,3-dichlorophenyl)piperidin-1-ium has a molecular weight of 231.15 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,3-dichlorophenyl)piperidin-1-ium is sourced from PubChem (CID 7048050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).