About 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol
2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol (PubChem CID 70480769) has the molecular formula C7H11Br2ClO
and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol |
| PubChem CID | 70480769 |
| Molecular Formula | C7H11Br2ClO |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 303.89 |
| IUPAC Name | 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol |
| SMILES | OCCC1C(CCCl)C1(Br)Br |
| InChI | InChI=1S/C7H11Br2ClO/c8-7(9)5(1-3-10)6(7)2-4-11/h5-6,11H,1-4H2 |
| InChIKey | PYNGMENVFVOGMU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol?
The IUPAC name of 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol (CID 70480769) is 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol.
What is the SMILES notation for 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol?
The canonical SMILES for 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol is OCCC1C(CCCl)C1(Br)Br.
What is the InChIKey of 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol?
The InChIKey is PYNGMENVFVOGMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11Br2ClO/c8-7(9)5(1-3-10)6(7)2-4-11/h5-6,11H,1-4H2.
What are the key properties of 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol?
2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol has a molecular weight of 306.43 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dibromo-3-(2-chloroethyl)cyclopropyl]ethanol is sourced from PubChem (CID 70480769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).