About N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide
N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide (PubChem CID 70481443) has the molecular formula C13H16N2O5
and a molecular weight of 280.28 g/mol. Its IUPAC name is N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide |
| PubChem CID | 70481443 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H]1C(=O)N(O)C1C |
| InChI | InChI=1S/C13H16N2O5/c1-7-11(13(17)15(7)18)14-12(16)10-8(19-2)5-4-6-9(10)20-3/h4-7,11,18H,1-3H3,(H,14,16)/t7?,11-/m0/s1 |
| InChIKey | SLWHTCHZYVUACL-QRIDDKLISA-N |
| XLogP | 0.42 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide?
The IUPAC name of N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide (CID 70481443) is N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide.
What is the SMILES notation for N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide?
The canonical SMILES for N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide is COc1cccc(OC)c1C(=O)N[C@@H]1C(=O)N(O)C1C.
What is the InChIKey of N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide?
The InChIKey is SLWHTCHZYVUACL-QRIDDKLISA-N. The full InChI is InChI=1S/C13H16N2O5/c1-7-11(13(17)15(7)18)14-12(16)10-8(19-2)5-4-6-9(10)20-3/h4-7,11,18H,1-3H3,(H,14,16)/t7?,11-/m0/s1.
What are the key properties of N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide?
N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide has a molecular weight of 280.28 g/mol, XLogP of 0.42, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1-hydroxy-2-methyl-4-oxoazetidin-3-yl]-2,6-dimethoxybenzamide is sourced from PubChem (CID 70481443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).