C24H35BrN2Si — CID 70481518
[(6aR,10aR)-5-bromo-7,9-diethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]-tert-butyl-dimethylsilane (PubChem CID 70481518) has the molecular formula C24H35BrN2Si and a molecular weight of 459.55 g/mol. Its IUPAC name is [(6aR,10aR)-5-bromo-7,9-diethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]-tert-butyl-dimethylsilane.
| Compound Name | [(6aR,10aR)-5-bromo-7,9-diethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 70481518 |
| Molecular Formula | C24H35BrN2Si |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [(6aR,10aR)-5-bromo-7,9-diethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl]-tert-butyl-dimethylsilane |
| SMILES | CCC1=C[C@@H]2c3cccc4c3c(c(Br)n4[Si](C)(C)C(C)(C)C)C[C@H]2N(CC)C1 |
| InChI | InChI=1S/C24H35BrN2Si/c1-8-16-13-18-17-11-10-12-20-22(17)19(14-21(18)26(9-2)15-16)23(25)27(20)28(6,7)24(3,4)5/h10-13,18,21H,8-9,14-15H2,1-7H3/t18-,21-/m1/s1 |
| InChIKey | RYCDYKHEIMAACX-WIYYLYMNSA-N |
| XLogP | 6.94 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|