About 5-chloro-3,4-diphenylpyridazine
5-chloro-3,4-diphenylpyridazine (PubChem CID 70481559) has the molecular formula C16H11ClN2
and a molecular weight of 266.73 g/mol. Its IUPAC name is 5-chloro-3,4-diphenylpyridazine.
Molecular Properties
| Compound Name | 5-chloro-3,4-diphenylpyridazine |
| PubChem CID | 70481559 |
| Molecular Formula | C16H11ClN2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 5-chloro-3,4-diphenylpyridazine |
| SMILES | Clc1cnnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C16H11ClN2/c17-14-11-18-19-16(13-9-5-2-6-10-13)15(14)12-7-3-1-4-8-12/h1-11H |
| InChIKey | DRVXYPSBAFMLGP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-3,4-diphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,4-diphenylpyridazine?
The IUPAC name of 5-chloro-3,4-diphenylpyridazine (CID 70481559) is 5-chloro-3,4-diphenylpyridazine.
What is the SMILES notation for 5-chloro-3,4-diphenylpyridazine?
The canonical SMILES for 5-chloro-3,4-diphenylpyridazine is Clc1cnnc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 5-chloro-3,4-diphenylpyridazine?
The InChIKey is DRVXYPSBAFMLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2/c17-14-11-18-19-16(13-9-5-2-6-10-13)15(14)12-7-3-1-4-8-12/h1-11H.
What are the key properties of 5-chloro-3,4-diphenylpyridazine?
5-chloro-3,4-diphenylpyridazine has a molecular weight of 266.73 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,4-diphenylpyridazine is sourced from PubChem (CID 70481559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).