About 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol
1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol (PubChem CID 70481579) has the molecular formula C7H11Br2ClO
and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol.
Molecular Properties
| Compound Name | 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol |
| PubChem CID | 70481579 |
| Molecular Formula | C7H11Br2ClO |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 303.89 |
| IUPAC Name | 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol |
| SMILES | CC(Cl)[C@@H]1[C@H](C(C)O)C1(Br)Br |
| InChI | InChI=1S/C7H11Br2ClO/c1-3(10)5-6(4(2)11)7(5,8)9/h3-6,11H,1-2H3/t3?,4?,5-,6+/m1/s1 |
| InChIKey | UHRWPTZUYLXWFT-KTGMNZKDSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol?
The IUPAC name of 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol (CID 70481579) is 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol.
What is the SMILES notation for 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol?
The canonical SMILES for 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol is CC(Cl)[C@@H]1[C@H](C(C)O)C1(Br)Br.
What is the InChIKey of 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol?
The InChIKey is UHRWPTZUYLXWFT-KTGMNZKDSA-N. The full InChI is InChI=1S/C7H11Br2ClO/c1-3(10)5-6(4(2)11)7(5,8)9/h3-6,11H,1-2H3/t3?,4?,5-,6+/m1/s1.
What are the key properties of 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol?
1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol has a molecular weight of 306.43 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,3S)-2,2-dibromo-3-(1-chloroethyl)cyclopropyl]ethanol is sourced from PubChem (CID 70481579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).