About 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole
2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole (PubChem CID 70481753) has the molecular formula C21H40N2
and a molecular weight of 320.57 g/mol. Its IUPAC name is 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 70481753 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole |
| SMILES | CCCCCCCC/C=C(/CCCCCCCC)C1=NCCN1 |
| InChI | InChI=1S/C21H40N2/c1-3-5-7-9-11-13-15-17-20(21-22-18-19-23-21)16-14-12-10-8-6-4-2/h17H,3-16,18-19H2,1-2H3,(H,22,23)/b20-17- |
| InChIKey | NLEILAHQAWVQGY-JZJYNLBNSA-N |
| XLogP | 6.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole (CID 70481753) is 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole is CCCCCCCC/C=C(/CCCCCCCC)C1=NCCN1.
What is the InChIKey of 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole?
The InChIKey is NLEILAHQAWVQGY-JZJYNLBNSA-N. The full InChI is InChI=1S/C21H40N2/c1-3-5-7-9-11-13-15-17-20(21-22-18-19-23-21)16-14-12-10-8-6-4-2/h17H,3-16,18-19H2,1-2H3,(H,22,23)/b20-17-.
What are the key properties of 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole?
2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole has a molecular weight of 320.57 g/mol, XLogP of 6.42, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-octadec-9-en-9-yl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 70481753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).