C11H15N3O — CID 70481775
2,3,4,4a,5,5a,6,8-octahydro-1H-pyrido[2,3-g]quinazolin-7-one (PubChem CID 70481775) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2,3,4,4a,5,5a,6,8-octahydro-1H-pyrido[2,3-g]quinazolin-7-one.
| Compound Name | 2,3,4,4a,5,5a,6,8-octahydro-1H-pyrido[2,3-g]quinazolin-7-one |
|---|---|
| PubChem CID | 70481775 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2,3,4,4a,5,5a,6,8-octahydro-1H-pyrido[2,3-g]quinazolin-7-one |
| SMILES | O=C1CC=C2C=C3NCNCC3CC2N1 |
| InChI | InChI=1S/C11H15N3O/c15-11-2-1-7-3-9-8(4-10(7)14-11)5-12-6-13-9/h1,3,8,10,12-13H,2,4-6H2,(H,14,15) |
| InChIKey | ZXHJDCAGPPNONN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |