C17H18O5S — CID 70481808
4,6-dimethyl-2-(phenylsulfanylmethoxy)cyclohexa-3,6-diene-1,3-dicarboxylic acid (PubChem CID 70481808) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is 4,6-dimethyl-2-(phenylsulfanylmethoxy)cyclohexa-3,6-diene-1,3-dicarboxylic acid.
| Compound Name | 4,6-dimethyl-2-(phenylsulfanylmethoxy)cyclohexa-3,6-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 70481808 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 4,6-dimethyl-2-(phenylsulfanylmethoxy)cyclohexa-3,6-diene-1,3-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(OCSc2ccccc2)C(C(=O)O)=C(C)C1 |
| InChI | InChI=1S/C17H18O5S/c1-10-8-11(2)14(17(20)21)15(13(10)16(18)19)22-9-23-12-6-4-3-5-7-12/h3-7,15H,8-9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | VBYFQFVSDPGGPX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|