About (5-aminoquinolin-6-yl) hydrogen carbonate
(5-aminoquinolin-6-yl) hydrogen carbonate (PubChem CID 70482347) has the molecular formula C10H8N2O3
and a molecular weight of 204.19 g/mol. Its IUPAC name is (5-aminoquinolin-6-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (5-aminoquinolin-6-yl) hydrogen carbonate |
| PubChem CID | 70482347 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (5-aminoquinolin-6-yl) hydrogen carbonate |
| SMILES | Nc1c(OC(=O)O)ccc2ncccc12 |
| InChI | InChI=1S/C10H8N2O3/c11-9-6-2-1-5-12-7(6)3-4-8(9)15-10(13)14/h1-5H,11H2,(H,13,14) |
| InChIKey | DGJCVHDBVLZUMU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (5-aminoquinolin-6-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-aminoquinolin-6-yl) hydrogen carbonate?
The IUPAC name of (5-aminoquinolin-6-yl) hydrogen carbonate (CID 70482347) is (5-aminoquinolin-6-yl) hydrogen carbonate.
What is the SMILES notation for (5-aminoquinolin-6-yl) hydrogen carbonate?
The canonical SMILES for (5-aminoquinolin-6-yl) hydrogen carbonate is Nc1c(OC(=O)O)ccc2ncccc12.
What is the InChIKey of (5-aminoquinolin-6-yl) hydrogen carbonate?
The InChIKey is DGJCVHDBVLZUMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c11-9-6-2-1-5-12-7(6)3-4-8(9)15-10(13)14/h1-5H,11H2,(H,13,14).
What are the key properties of (5-aminoquinolin-6-yl) hydrogen carbonate?
(5-aminoquinolin-6-yl) hydrogen carbonate has a molecular weight of 204.19 g/mol, XLogP of 1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-aminoquinolin-6-yl) hydrogen carbonate is sourced from PubChem (CID 70482347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).