About 1-[(2,3-dichlorophenyl)methyl]naphthalene
1-[(2,3-dichlorophenyl)methyl]naphthalene (PubChem CID 70482363) has the molecular formula C17H12Cl2
and a molecular weight of 287.19 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]naphthalene.
Molecular Properties
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]naphthalene |
| PubChem CID | 70482363 |
| Molecular Formula | C17H12Cl2 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]naphthalene |
| SMILES | Clc1cccc(Cc2cccc3ccccc23)c1Cl |
| InChI | InChI=1S/C17H12Cl2/c18-16-10-4-8-14(17(16)19)11-13-7-3-6-12-5-1-2-9-15(12)13/h1-10H,11H2 |
| InChIKey | OFJFTBCDWYRKMI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(2,3-dichlorophenyl)methyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,3-dichlorophenyl)methyl]naphthalene?
The IUPAC name of 1-[(2,3-dichlorophenyl)methyl]naphthalene (CID 70482363) is 1-[(2,3-dichlorophenyl)methyl]naphthalene.
What is the SMILES notation for 1-[(2,3-dichlorophenyl)methyl]naphthalene?
The canonical SMILES for 1-[(2,3-dichlorophenyl)methyl]naphthalene is Clc1cccc(Cc2cccc3ccccc23)c1Cl.
What is the InChIKey of 1-[(2,3-dichlorophenyl)methyl]naphthalene?
The InChIKey is OFJFTBCDWYRKMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2/c18-16-10-4-8-14(17(16)19)11-13-7-3-6-12-5-1-2-9-15(12)13/h1-10H,11H2.
What are the key properties of 1-[(2,3-dichlorophenyl)methyl]naphthalene?
1-[(2,3-dichlorophenyl)methyl]naphthalene has a molecular weight of 287.19 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,3-dichlorophenyl)methyl]naphthalene is sourced from PubChem (CID 70482363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).