C12H15F3N6O4S — CID 70482388
(Z)-4-oxo-4-[3-[[5-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1H-1,2,4-triazol-3-yl]sulfanyl]propoxy]but-2-enoic acid (PubChem CID 70482388) has the molecular formula C12H15F3N6O4S and a molecular weight of 396.35 g/mol. Its IUPAC name is (Z)-4-oxo-4-[3-[[5-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1H-1,2,4-triazol-3-yl]sulfanyl]propoxy]but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[3-[[5-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1H-1,2,4-triazol-3-yl]sulfanyl]propoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 70482388 |
| Molecular Formula | C12H15F3N6O4S |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (Z)-4-oxo-4-[3-[[5-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1H-1,2,4-triazol-3-yl]sulfanyl]propoxy]but-2-enoic acid |
| SMILES | N/C(=N\CC(F)(F)F)Nc1nc(SCCCOC(=O)/C=C\C(=O)O)n[nH]1 |
| InChI | InChI=1S/C12H15F3N6O4S/c13-12(14,15)6-17-9(16)18-10-19-11(21-20-10)26-5-1-4-25-8(24)3-2-7(22)23/h2-3H,1,4-6H2,(H,22,23)(H4,16,17,18,19,20,21)/b3-2- |
| InChIKey | SBOGUKMEMMIHMD-IHWYPQMZSA-N |
| XLogP | 0.76 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|