C16H12N4O3 — CID 704824
N-[4-(furan-2-carbonylamino)phenyl]pyrazine-2-carboxamide (PubChem CID 704824) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is N-[4-(furan-2-carbonylamino)phenyl]pyrazine-2-carboxamide.
| Compound Name | N-[4-(furan-2-carbonylamino)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 704824 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[4-(furan-2-carbonylamino)phenyl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccco2)cc1)c1cnccn1 |
| InChI | InChI=1S/C16H12N4O3/c21-15(13-10-17-7-8-18-13)19-11-3-5-12(6-4-11)20-16(22)14-2-1-9-23-14/h1-10H,(H,19,21)(H,20,22) |
| InChIKey | KRGJYPPTBCQPGE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |