C13H16F2O2 — CID 70482555
2,3-difluorobicyclo[2.2.0]hexa-1,3,5-triene;methanol;3-prop-2-enoxyprop-1-ene (PubChem CID 70482555) has the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. Its IUPAC name is 2,3-difluorobicyclo[2.2.0]hexa-1,3,5-triene;methanol;3-prop-2-enoxyprop-1-ene.
| Compound Name | 2,3-difluorobicyclo[2.2.0]hexa-1,3,5-triene;methanol;3-prop-2-enoxyprop-1-ene |
|---|---|
| PubChem CID | 70482555 |
| Molecular Formula | C13H16F2O2 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2,3-difluorobicyclo[2.2.0]hexa-1,3,5-triene;methanol;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.CO.Fc1c2ccc-2c1F |
| InChI | InChI=1S/C6H2F2.C6H10O.CH4O/c7-5-3-1-2-4(3)6(5)8;1-3-5-7-6-4-2;1-2/h1-2H;3-4H,1-2,5-6H2;2H,1H3 |
| InChIKey | PQGKUMLULCKFBN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|