C9H13N — CID 70482612
6-methyl-2,3,3a,4-tetrahydro-1H-indole (PubChem CID 70482612) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 6-methyl-2,3,3a,4-tetrahydro-1H-indole.
| Compound Name | 6-methyl-2,3,3a,4-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 70482612 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 6-methyl-2,3,3a,4-tetrahydro-1H-indole |
| SMILES | CC1=CCC2CCNC2=C1 |
| InChI | InChI=1S/C9H13N/c1-7-2-3-8-4-5-10-9(8)6-7/h2,6,8,10H,3-5H2,1H3 |
| InChIKey | XYWJGIKKDYBECN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |