About 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide
7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide (PubChem CID 70482773) has the molecular formula C8H8ClNOS
and a molecular weight of 201.68 g/mol. Its IUPAC name is 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide.
Molecular Properties
| Compound Name | 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide |
| PubChem CID | 70482773 |
| Molecular Formula | C8H8ClNOS |
| Molecular Weight | 201.68 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide |
| SMILES | O=S1NCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C8H8ClNOS/c9-7-2-1-6-3-4-10-12(11)8(6)5-7/h1-2,5,10H,3-4H2 |
| InChIKey | LGINAXNGTRZMOU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide?
The IUPAC name of 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide (CID 70482773) is 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide.
What is the SMILES notation for 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide?
The canonical SMILES for 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide is O=S1NCCc2ccc(Cl)cc21.
What is the InChIKey of 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide?
The InChIKey is LGINAXNGTRZMOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNOS/c9-7-2-1-6-3-4-10-12(11)8(6)5-7/h1-2,5,10H,3-4H2.
What are the key properties of 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide?
7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide has a molecular weight of 201.68 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3,4-dihydro-2H-1λ4,2-benzothiazine 1-oxide is sourced from PubChem (CID 70482773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).