C13H20NS+ — CID 7048294
(2S)-2-(2-methylsulfanylphenyl)azepan-1-ium (PubChem CID 7048294) has the molecular formula C13H20NS+ and a molecular weight of 222.38 g/mol. Its IUPAC name is (2S)-2-(2-methylsulfanylphenyl)azepan-1-ium.
| Compound Name | (2S)-2-(2-methylsulfanylphenyl)azepan-1-ium |
|---|---|
| PubChem CID | 7048294 |
| Molecular Formula | C13H20NS+ |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2S)-2-(2-methylsulfanylphenyl)azepan-1-ium |
| SMILES | CSc1ccccc1[C@@H]1CCCCC[NH2+]1 |
| InChI | InChI=1S/C13H19NS/c1-15-13-9-5-4-7-11(13)12-8-3-2-6-10-14-12/h4-5,7,9,12,14H,2-3,6,8,10H2,1H3/p+1/t12-/m0/s1 |
| InChIKey | NETSUPARTVOWIS-LBPRGKRZSA-O |
| XLogP | 2.59 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |