About 6H-[1,2]oxazolo[4,5-f]quinolin-7-one
6H-[1,2]oxazolo[4,5-f]quinolin-7-one (PubChem CID 70483060) has the molecular formula C10H6N2O2
and a molecular weight of 186.17 g/mol. Its IUPAC name is 6H-[1,2]oxazolo[4,5-f]quinolin-7-one.
Molecular Properties
| Compound Name | 6H-[1,2]oxazolo[4,5-f]quinolin-7-one |
| PubChem CID | 70483060 |
| Molecular Formula | C10H6N2O2 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 6H-[1,2]oxazolo[4,5-f]quinolin-7-one |
| SMILES | O=c1ccc2c(ccc3oncc32)[nH]1 |
| InChI | InChI=1S/C10H6N2O2/c13-10-4-1-6-7-5-11-14-9(7)3-2-8(6)12-10/h1-5H,(H,12,13) |
| InChIKey | FKTNSEABFBHIEI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6H-[1,2]oxazolo[4,5-f]quinolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-[1,2]oxazolo[4,5-f]quinolin-7-one?
The IUPAC name of 6H-[1,2]oxazolo[4,5-f]quinolin-7-one (CID 70483060) is 6H-[1,2]oxazolo[4,5-f]quinolin-7-one.
What is the SMILES notation for 6H-[1,2]oxazolo[4,5-f]quinolin-7-one?
The canonical SMILES for 6H-[1,2]oxazolo[4,5-f]quinolin-7-one is O=c1ccc2c(ccc3oncc32)[nH]1.
What is the InChIKey of 6H-[1,2]oxazolo[4,5-f]quinolin-7-one?
The InChIKey is FKTNSEABFBHIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2/c13-10-4-1-6-7-5-11-14-9(7)3-2-8(6)12-10/h1-5H,(H,12,13).
What are the key properties of 6H-[1,2]oxazolo[4,5-f]quinolin-7-one?
6H-[1,2]oxazolo[4,5-f]quinolin-7-one has a molecular weight of 186.17 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-[1,2]oxazolo[4,5-f]quinolin-7-one is sourced from PubChem (CID 70483060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).