C26H46O2Si — CID 70483069
(8S,9S,10R,13S,14S,17S)-17-(2-hydroxy-4-trimethylsilylbutan-2-yl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-ol (PubChem CID 70483069) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-(2-hydroxy-4-trimethylsilylbutan-2-yl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-(2-hydroxy-4-trimethylsilylbutan-2-yl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 70483069 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-(2-hydroxy-4-trimethylsilylbutan-2-yl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(O)(CC[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CCC4CC(O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H46O2Si/c1-24-13-11-19(27)17-18(24)7-8-20-21-9-10-23(25(21,2)14-12-22(20)24)26(3,28)15-16-29(4,5)6/h11,13,18-23,27-28H,7-10,12,14-17H2,1-6H3/t18?,19?,20-,21-,22-,23-,24-,25-,26?/m0/s1 |
| InChIKey | RFSIJVCZZMDRMG-WFPAWZFHSA-N |
| XLogP | 6.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|