C31H52O6 — CID 70484188
methyl 7-[(4R,5R)-4-(oxan-2-yloxy)-5-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopenten-1-yl]heptanoate (PubChem CID 70484188) has the molecular formula C31H52O6 and a molecular weight of 520.75 g/mol. Its IUPAC name is methyl 7-[(4R,5R)-4-(oxan-2-yloxy)-5-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopenten-1-yl]heptanoate.
| Compound Name | methyl 7-[(4R,5R)-4-(oxan-2-yloxy)-5-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 70484188 |
| Molecular Formula | C31H52O6 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | methyl 7-[(4R,5R)-4-(oxan-2-yloxy)-5-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopenten-1-yl]heptanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1C(CCCCCCC(=O)OC)=CC[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C31H52O6/c1-3-4-7-15-26(36-30-17-10-12-23-34-30)20-21-27-25(14-8-5-6-9-16-29(32)33-2)19-22-28(27)37-31-18-11-13-24-35-31/h19-21,26-28,30-31H,3-18,22-24H2,1-2H3/b21-20+/t26-,27+,28+,30?,31?/m0/s1 |
| InChIKey | WUCQYHKDWVSSNR-AIEIBFBESA-N |
| XLogP | 7.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|