About 1,3-dimethyl-7,8-dihydro-2H-purine
1,3-dimethyl-7,8-dihydro-2H-purine (PubChem CID 70484384) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1,3-dimethyl-7,8-dihydro-2H-purine.
Molecular Properties
| Compound Name | 1,3-dimethyl-7,8-dihydro-2H-purine |
| PubChem CID | 70484384 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 1,3-dimethyl-7,8-dihydro-2H-purine |
| SMILES | CN1C=C2NCN=C2N(C)C1 |
| InChI | InChI=1S/C7H12N4/c1-10-3-6-7(9-4-8-6)11(2)5-10/h3,8H,4-5H2,1-2H3 |
| InChIKey | PNXLJYPWLIROQS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethyl-7,8-dihydro-2H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-7,8-dihydro-2H-purine?
The IUPAC name of 1,3-dimethyl-7,8-dihydro-2H-purine (CID 70484384) is 1,3-dimethyl-7,8-dihydro-2H-purine.
What is the SMILES notation for 1,3-dimethyl-7,8-dihydro-2H-purine?
The canonical SMILES for 1,3-dimethyl-7,8-dihydro-2H-purine is CN1C=C2NCN=C2N(C)C1.
What is the InChIKey of 1,3-dimethyl-7,8-dihydro-2H-purine?
The InChIKey is PNXLJYPWLIROQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-10-3-6-7(9-4-8-6)11(2)5-10/h3,8H,4-5H2,1-2H3.
What are the key properties of 1,3-dimethyl-7,8-dihydro-2H-purine?
1,3-dimethyl-7,8-dihydro-2H-purine has a molecular weight of 152.20 g/mol, XLogP of -0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-7,8-dihydro-2H-purine is sourced from PubChem (CID 70484384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).