About 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine
3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine (PubChem CID 70484508) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine.
Molecular Properties
| Compound Name | 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine |
| PubChem CID | 70484508 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine |
| SMILES | C1=CCCCC(C2=NN=CCCC2)=C1 |
| InChI | InChI=1S/C12H16N2/c1-2-4-8-11(7-3-1)12-9-5-6-10-13-14-12/h1,3,7,10H,2,4-6,8-9H2 |
| InChIKey | OTCCBQHVBALMLO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine?
The IUPAC name of 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine (CID 70484508) is 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine.
What is the SMILES notation for 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine?
The canonical SMILES for 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine is C1=CCCCC(C2=NN=CCCC2)=C1.
What is the InChIKey of 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine?
The InChIKey is OTCCBQHVBALMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-2-4-8-11(7-3-1)12-9-5-6-10-13-14-12/h1,3,7,10H,2,4-6,8-9H2.
What are the key properties of 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine?
3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine has a molecular weight of 188.27 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohepta-1,3-dien-1-yl-5,6-dihydro-4H-diazepine is sourced from PubChem (CID 70484508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).