C16H25N3O — CID 70484697
6-cyclohexyl-2,2-dimethyl-4-(1,2,4-triazol-1-yl)hex-5-en-3-one (PubChem CID 70484697) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 6-cyclohexyl-2,2-dimethyl-4-(1,2,4-triazol-1-yl)hex-5-en-3-one.
| Compound Name | 6-cyclohexyl-2,2-dimethyl-4-(1,2,4-triazol-1-yl)hex-5-en-3-one |
|---|---|
| PubChem CID | 70484697 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 6-cyclohexyl-2,2-dimethyl-4-(1,2,4-triazol-1-yl)hex-5-en-3-one |
| SMILES | CC(C)(C)C(=O)C(C=CC1CCCCC1)n1cncn1 |
| InChI | InChI=1S/C16H25N3O/c1-16(2,3)15(20)14(19-12-17-11-18-19)10-9-13-7-5-4-6-8-13/h9-14H,4-8H2,1-3H3 |
| InChIKey | MLTOZBQMVNEFMZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|