C21H23N5OS — CID 70485446
(6aR)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5-carboxamide (PubChem CID 70485446) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is (6aR)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5-carboxamide.
| Compound Name | (6aR)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 70485446 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (6aR)-N-(5-methyl-1,3,4-thiadiazol-2-yl)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-5-carboxamide |
| SMILES | C=CCN1CCCC2c3cccc4[nH]c(C(=O)Nc5nnc(C)s5)c(c34)C[C@H]21 |
| InChI | InChI=1S/C21H23N5OS/c1-3-9-26-10-5-7-13-14-6-4-8-16-18(14)15(11-17(13)26)19(22-16)20(27)23-21-25-24-12(2)28-21/h3-4,6,8,13,17,22H,1,5,7,9-11H2,2H3,(H,23,25,27)/t13?,17-/m1/s1 |
| InChIKey | KCZTYTRSWPGGHU-LRHAYUFXSA-N |
| XLogP | 3.87 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|