C16H24ClNO2 — CID 70485567
7,10-dimethoxy-4-methyl-2,3,4a,5,6,10-hexahydro-1H-benzo[f]quinoline;hydrochloride (PubChem CID 70485567) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 7,10-dimethoxy-4-methyl-2,3,4a,5,6,10-hexahydro-1H-benzo[f]quinoline;hydrochloride.
| Compound Name | 7,10-dimethoxy-4-methyl-2,3,4a,5,6,10-hexahydro-1H-benzo[f]quinoline;hydrochloride |
|---|---|
| PubChem CID | 70485567 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 7,10-dimethoxy-4-methyl-2,3,4a,5,6,10-hexahydro-1H-benzo[f]quinoline;hydrochloride |
| SMILES | COC1=C2CCC3C(=C2C(OC)C=C1)CCCN3C.Cl |
| InChI | InChI=1S/C16H23NO2.ClH/c1-17-10-4-5-11-13(17)7-6-12-14(18-2)8-9-15(19-3)16(11)12;/h8-9,13,15H,4-7,10H2,1-3H3;1H |
| InChIKey | SJORAQZPUVMCLY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |