About 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate
4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate (PubChem CID 70485602) has the molecular formula C12H18N2O6
and a molecular weight of 286.28 g/mol. Its IUPAC name is 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate |
| PubChem CID | 70485602 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate |
| SMILES | CCN1CC(=O)N(COC(=O)CCC(=O)OC)C(=O)C1 |
| InChI | InChI=1S/C12H18N2O6/c1-3-13-6-9(15)14(10(16)7-13)8-20-12(18)5-4-11(17)19-2/h3-8H2,1-2H3 |
| InChIKey | QAFVMWFNRPIXEV-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate?
The IUPAC name of 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate (CID 70485602) is 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate?
The canonical SMILES for 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate is CCN1CC(=O)N(COC(=O)CCC(=O)OC)C(=O)C1.
What is the InChIKey of 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate?
The InChIKey is QAFVMWFNRPIXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O6/c1-3-13-6-9(15)14(10(16)7-13)8-20-12(18)5-4-11(17)19-2/h3-8H2,1-2H3.
What are the key properties of 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate?
4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate has a molecular weight of 286.28 g/mol, XLogP of -0.87, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[(4-ethyl-2,6-dioxopiperazin-1-yl)methyl] 1-O-methyl butanedioate is sourced from PubChem (CID 70485602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).