C11H14N2 — CID 70485609
2,3,3a,4,5,5a-hexahydro-1H-pyrrolo[2,3-f]quinoline (PubChem CID 70485609) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3,3a,4,5,5a-hexahydro-1H-pyrrolo[2,3-f]quinoline.
| Compound Name | 2,3,3a,4,5,5a-hexahydro-1H-pyrrolo[2,3-f]quinoline |
|---|---|
| PubChem CID | 70485609 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3,3a,4,5,5a-hexahydro-1H-pyrrolo[2,3-f]quinoline |
| SMILES | C1=CC2=C3NCCC3CCC2N=C1 |
| InChI | InChI=1S/C11H14N2/c1-2-9-10(12-6-1)4-3-8-5-7-13-11(8)9/h1-2,6,8,10,13H,3-5,7H2 |
| InChIKey | WZLUFAVWAZKFAI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |