C37H57NO3 — CID 70485668
[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 5-ethylpyridine-2-carboxylate (PubChem CID 70485668) has the molecular formula C37H57NO3 and a molecular weight of 563.87 g/mol. Its IUPAC name is [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 5-ethylpyridine-2-carboxylate.
| Compound Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 5-ethylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 70485668 |
| Molecular Formula | C37H57NO3 |
| Molecular Weight | 563.87 g/mol |
| Exact Mass | 563.43 |
| IUPAC Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] 5-ethylpyridine-2-carboxylate |
| SMILES | CCc1ccc(C(=O)Oc2c(C)c(C)c3c(c2C)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O3)nc1 |
| InChI | InChI=1S/C37H57NO3/c1-10-31-19-20-33(38-24-31)36(39)40-34-28(6)29(7)35-32(30(34)8)21-23-37(9,41-35)22-13-18-27(5)17-12-16-26(4)15-11-14-25(2)3/h19-20,24-27H,10-18,21-23H2,1-9H3/t26-,27-,37-/m1/s1 |
| InChIKey | OMKWJBZCOFLLRB-URVHLYLLSA-N |
| XLogP | 10.31 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.87 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|