About 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine
3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine (PubChem CID 70485777) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine |
| PubChem CID | 70485777 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine |
| SMILES | C=CCN(CC=C)c1cccc(N)c1 |
| InChI | InChI=1S/C12H16N2/c1-3-8-14(9-4-2)12-7-5-6-11(13)10-12/h3-7,10H,1-2,8-9,13H2 |
| InChIKey | LTRPESMVWINMPR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine?
The IUPAC name of 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine (CID 70485777) is 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine.
What is the SMILES notation for 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine?
The canonical SMILES for 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine is C=CCN(CC=C)c1cccc(N)c1.
What is the InChIKey of 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine?
The InChIKey is LTRPESMVWINMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-3-8-14(9-4-2)12-7-5-6-11(13)10-12/h3-7,10H,1-2,8-9,13H2.
What are the key properties of 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine?
3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine has a molecular weight of 188.27 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-bis(prop-2-enyl)benzene-1,3-diamine is sourced from PubChem (CID 70485777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).