About 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol
4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol (PubChem CID 70485783) has the molecular formula C18H22N2O6
and a molecular weight of 362.38 g/mol. Its IUPAC name is 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol.
Molecular Properties
| Compound Name | 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol |
| PubChem CID | 70485783 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol |
| SMILES | CC(O)O.N#CC1CCC(C(=O)O)CC1.N#Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H11NO2.C8H5NO2.C2H6O2/c2*9-5-6-1-3-7(4-2-6)8(10)11;1-2(3)4/h6-7H,1-4H2,(H,10,11);1-4H,(H,10,11);2-4H,1H3 |
| InChIKey | MPOOTOGIRNLOGM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 162.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol?
The IUPAC name of 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol (CID 70485783) is 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol.
What is the SMILES notation for 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol?
The canonical SMILES for 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol is CC(O)O.N#CC1CCC(C(=O)O)CC1.N#Cc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol?
The InChIKey is MPOOTOGIRNLOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.C8H5NO2.C2H6O2/c2*9-5-6-1-3-7(4-2-6)8(10)11;1-2(3)4/h6-7H,1-4H2,(H,10,11);1-4H,(H,10,11);2-4H,1H3.
What are the key properties of 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol?
4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol has a molecular weight of 362.38 g/mol, XLogP of 1.97, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanobenzoic acid;4-cyanocyclohexane-1-carboxylic acid;ethane-1,1-diol is sourced from PubChem (CID 70485783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).