C18H24O — CID 70485827
1,1,3,3,8-pentamethyl-2,5,7,8-tetrahydrocyclopenta[b]naphthalen-6-one (PubChem CID 70485827) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 1,1,3,3,8-pentamethyl-2,5,7,8-tetrahydrocyclopenta[b]naphthalen-6-one.
| Compound Name | 1,1,3,3,8-pentamethyl-2,5,7,8-tetrahydrocyclopenta[b]naphthalen-6-one |
|---|---|
| PubChem CID | 70485827 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1,1,3,3,8-pentamethyl-2,5,7,8-tetrahydrocyclopenta[b]naphthalen-6-one |
| SMILES | CC1CC(=O)Cc2cc3c(cc21)C(C)(C)CC3(C)C |
| InChI | InChI=1S/C18H24O/c1-11-6-13(19)7-12-8-15-16(9-14(11)12)18(4,5)10-17(15,2)3/h8-9,11H,6-7,10H2,1-5H3 |
| InChIKey | RKICEXAMPMOWBS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |