About methylhydrazine;1H-pyrimidine-2,4-dione
methylhydrazine;1H-pyrimidine-2,4-dione (PubChem CID 70486662) has the molecular formula C5H10N4O2
and a molecular weight of 158.16 g/mol. Its IUPAC name is methylhydrazine;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | methylhydrazine;1H-pyrimidine-2,4-dione |
| PubChem CID | 70486662 |
| Molecular Formula | C5H10N4O2 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | methylhydrazine;1H-pyrimidine-2,4-dione |
| SMILES | CNN.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2.CH6N2/c7-3-1-2-5-4(8)6-3;1-3-2/h1-2H,(H2,5,6,7,8);3H,2H2,1H3 |
| InChIKey | ZXMGFZYNICJTQN-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylhydrazine;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylhydrazine;1H-pyrimidine-2,4-dione?
The IUPAC name of methylhydrazine;1H-pyrimidine-2,4-dione (CID 70486662) is methylhydrazine;1H-pyrimidine-2,4-dione.
What is the SMILES notation for methylhydrazine;1H-pyrimidine-2,4-dione?
The canonical SMILES for methylhydrazine;1H-pyrimidine-2,4-dione is CNN.O=c1cc[nH]c(=O)[nH]1.
What is the InChIKey of methylhydrazine;1H-pyrimidine-2,4-dione?
The InChIKey is ZXMGFZYNICJTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.CH6N2/c7-3-1-2-5-4(8)6-3;1-3-2/h1-2H,(H2,5,6,7,8);3H,2H2,1H3.
What are the key properties of methylhydrazine;1H-pyrimidine-2,4-dione?
methylhydrazine;1H-pyrimidine-2,4-dione has a molecular weight of 158.16 g/mol, XLogP of -1.86, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylhydrazine;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 70486662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).