About [(2R)-2,3-dihydroxypropyl] phosphate
[(2R)-2,3-dihydroxypropyl] phosphate (PubChem CID 7048686) has the molecular formula C3H7O6P-2
and a molecular weight of 170.06 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] phosphate.
Molecular Properties
| Compound Name | [(2R)-2,3-dihydroxypropyl] phosphate |
| PubChem CID | 7048686 |
| Molecular Formula | C3H7O6P-2 |
| Molecular Weight | 170.06 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] phosphate |
| SMILES | O=P([O-])([O-])OC[C@H](O)CO |
| InChI | InChI=1S/C3H9O6P/c4-1-3(5)2-9-10(6,7)8/h3-5H,1-2H2,(H2,6,7,8)/p-2/t3-/m1/s1 |
| InChIKey | AWUCVROLDVIAJX-GSVOUGTGSA-L |
| XLogP | -2.82 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.06 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2,3-dihydroxypropyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2,3-dihydroxypropyl] phosphate?
The IUPAC name of [(2R)-2,3-dihydroxypropyl] phosphate (CID 7048686) is [(2R)-2,3-dihydroxypropyl] phosphate.
What is the SMILES notation for [(2R)-2,3-dihydroxypropyl] phosphate?
The canonical SMILES for [(2R)-2,3-dihydroxypropyl] phosphate is O=P([O-])([O-])OC[C@H](O)CO.
What is the InChIKey of [(2R)-2,3-dihydroxypropyl] phosphate?
The InChIKey is AWUCVROLDVIAJX-GSVOUGTGSA-L. The full InChI is InChI=1S/C3H9O6P/c4-1-3(5)2-9-10(6,7)8/h3-5H,1-2H2,(H2,6,7,8)/p-2/t3-/m1/s1.
What are the key properties of [(2R)-2,3-dihydroxypropyl] phosphate?
[(2R)-2,3-dihydroxypropyl] phosphate has a molecular weight of 170.06 g/mol, XLogP of -2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3-dihydroxypropyl] phosphate is sourced from PubChem (CID 7048686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).