C25H44N2O4 — CID 70486948
(1,2,2,6,6-pentamethylpiperidin-4-yl) prop-2-enoate;(2,2,6,6-tetramethylpiperidin-4-yl) prop-2-enoate (PubChem CID 70486948) has the molecular formula C25H44N2O4 and a molecular weight of 436.64 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) prop-2-enoate;(2,2,6,6-tetramethylpiperidin-4-yl) prop-2-enoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) prop-2-enoate;(2,2,6,6-tetramethylpiperidin-4-yl) prop-2-enoate |
|---|---|
| PubChem CID | 70486948 |
| Molecular Formula | C25H44N2O4 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) prop-2-enoate;(2,2,6,6-tetramethylpiperidin-4-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC(C)(C)N(C)C(C)(C)C1.C=CC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C13H23NO2.C12H21NO2/c1-7-11(15)16-10-8-12(2,3)14(6)13(4,5)9-10;1-6-10(14)15-9-7-11(2,3)13-12(4,5)8-9/h7,10H,1,8-9H2,2-6H3;6,9,13H,1,7-8H2,2-5H3 |
| InChIKey | ZLGNUZPWNWQMNY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|