C26H48N2O — CID 70487055
1,2,2,6,6-pentamethyl-4-[3-[3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoxy]prop-1-enyl]piperidine (PubChem CID 70487055) has the molecular formula C26H48N2O and a molecular weight of 404.68 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-[3-[3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoxy]prop-1-enyl]piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-[3-[3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoxy]prop-1-enyl]piperidine |
|---|---|
| PubChem CID | 70487055 |
| Molecular Formula | C26H48N2O |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.38 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-[3-[3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoxy]prop-1-enyl]piperidine |
| SMILES | CN1C(C)(C)CC(C=CCOCC=CC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C26H48N2O/c1-23(2)17-21(18-24(3,4)27(23)9)13-11-15-29-16-12-14-22-19-25(5,6)28(10)26(7,8)20-22/h11-14,21-22H,15-20H2,1-10H3 |
| InChIKey | BLIUCHAZEDMNFB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|