C13H14O6 — CID 70487385
[(2R,4R)-2,4-dihydroxy-5,8-dioxo-3,4-dihydro-1H-naphthalen-2-yl]methyl acetate (PubChem CID 70487385) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is [(2R,4R)-2,4-dihydroxy-5,8-dioxo-3,4-dihydro-1H-naphthalen-2-yl]methyl acetate.
| Compound Name | [(2R,4R)-2,4-dihydroxy-5,8-dioxo-3,4-dihydro-1H-naphthalen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70487385 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | [(2R,4R)-2,4-dihydroxy-5,8-dioxo-3,4-dihydro-1H-naphthalen-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(O)CC2=C(C(=O)C=CC2=O)[C@H](O)C1 |
| InChI | InChI=1S/C13H14O6/c1-7(14)19-6-13(18)4-8-9(15)2-3-10(16)12(8)11(17)5-13/h2-3,11,17-18H,4-6H2,1H3/t11-,13-/m1/s1 |
| InChIKey | PSEAKRQQDLEPAN-DGCLKSJQSA-N |
| XLogP | -0.56 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|