C10H20N4S — CID 70487845
2-N-(5-methylheptyl)-1,3,4-thiadiazole-2,5-diamine (PubChem CID 70487845) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-N-(5-methylheptyl)-1,3,4-thiadiazole-2,5-diamine.
| Compound Name | 2-N-(5-methylheptyl)-1,3,4-thiadiazole-2,5-diamine |
|---|---|
| PubChem CID | 70487845 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-N-(5-methylheptyl)-1,3,4-thiadiazole-2,5-diamine |
| SMILES | CCC(C)CCCCNc1nnc(N)s1 |
| InChI | InChI=1S/C10H20N4S/c1-3-8(2)6-4-5-7-12-10-14-13-9(11)15-10/h8H,3-7H2,1-2H3,(H2,11,13)(H,12,14) |
| InChIKey | MJXWHLWSMLUMFQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|