C35H46O8 — CID 70488159
2,2-bis[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]-3-methylidenebutanedioic acid (PubChem CID 70488159) has the molecular formula C35H46O8 and a molecular weight of 594.75 g/mol. Its IUPAC name is 2,2-bis[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]-3-methylidenebutanedioic acid.
| Compound Name | 2,2-bis[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 70488159 |
| Molecular Formula | C35H46O8 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | 2,2-bis[2-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)ethyl]-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(CCC1(C)CCc2c(C)c(O)c(C)c(C)c2O1)(CCC1(C)CCc2c(C)c(O)c(C)c(C)c2O1)C(=O)O |
| InChI | InChI=1S/C35H46O8/c1-18-20(3)29-25(22(5)27(18)36)10-12-33(8,42-29)14-16-35(32(40)41,24(7)31(38)39)17-15-34(9)13-11-26-23(6)28(37)19(2)21(4)30(26)43-34/h36-37H,7,10-17H2,1-6,8-9H3,(H,38,39)(H,40,41) |
| InChIKey | YRINUSXTIPQOSN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|