C14H24O3 — CID 7048829
(E)-5-hydroxy-2-methoxy-2,6,6-trimethyl-4-prop-2-enylhept-4-en-3-one (PubChem CID 7048829) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (E)-5-hydroxy-2-methoxy-2,6,6-trimethyl-4-prop-2-enylhept-4-en-3-one.
| Compound Name | (E)-5-hydroxy-2-methoxy-2,6,6-trimethyl-4-prop-2-enylhept-4-en-3-one |
|---|---|
| PubChem CID | 7048829 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (E)-5-hydroxy-2-methoxy-2,6,6-trimethyl-4-prop-2-enylhept-4-en-3-one |
| SMILES | C=CC/C(C(=O)C(C)(C)OC)=C(\O)C(C)(C)C |
| InChI | InChI=1S/C14H24O3/c1-8-9-10(11(15)13(2,3)4)12(16)14(5,6)17-7/h8,15H,1,9H2,2-7H3/b11-10+ |
| InChIKey | ZBIFUNBHSMZEMI-ZHACJKMWSA-N |
| XLogP | 3.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|