C17H29N4O2S+ — CID 7048892
2-[(1-cyclohexyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium (PubChem CID 7048892) has the molecular formula C17H29N4O2S+ and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-[(1-cyclohexyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium.
| Compound Name | 2-[(1-cyclohexyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7048892 |
| Molecular Formula | C17H29N4O2S+ |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-[(1-cyclohexyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CC/N=C/C1C(=O)NC(=S)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C17H28N4O2S/c1-3-20(4-2)11-10-18-12-14-15(22)19-17(24)21(16(14)23)13-8-6-5-7-9-13/h12-14H,3-11H2,1-2H3,(H,19,22,24)/p+1/b18-12+ |
| InChIKey | ONICETMOMUGXQI-LDADJPATSA-O |
| XLogP | 0.17 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|