C18H22F3N4O3+ — CID 7048902
diethyl-[2-[[2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium (PubChem CID 7048902) has the molecular formula C18H22F3N4O3+ and a molecular weight of 399.39 g/mol. Its IUPAC name is diethyl-[2-[[2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium.
| Compound Name | diethyl-[2-[[2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium |
|---|---|
| PubChem CID | 7048902 |
| Molecular Formula | C18H22F3N4O3+ |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | diethyl-[2-[[2,4,6-trioxo-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-yl]methylideneamino]ethyl]azanium |
| SMILES | CC[NH+](CC)CC/N=C/C1C(=O)NC(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H21F3N4O3/c1-3-24(4-2)9-8-22-11-14-15(26)23-17(28)25(16(14)27)13-7-5-6-12(10-13)18(19,20)21/h5-7,10-11,14H,3-4,8-9H2,1-2H3,(H,23,26,28)/p+1/b22-11+ |
| InChIKey | OUKPDILIDFZKQA-SSDVNMTOSA-O |
| XLogP | 0.90 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|