About N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene
N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene (PubChem CID 70489067) has the molecular formula C13H13F3N2O2
and a molecular weight of 286.25 g/mol. Its IUPAC name is N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene.
Molecular Properties
| Compound Name | N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene |
| PubChem CID | 70489067 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene |
| SMILES | CCC(=O)Nc1ncco1.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C7H5F3.C6H8N2O2/c8-7(9,10)6-4-2-1-3-5-6;1-2-5(9)8-6-7-3-4-10-6/h1-5H;3-4H,2H2,1H3,(H,7,8,9) |
| InChIKey | ITVJGWVSDDCUHW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene?
The IUPAC name of N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene (CID 70489067) is N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene.
What is the SMILES notation for N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene?
The canonical SMILES for N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene is CCC(=O)Nc1ncco1.FC(F)(F)c1ccccc1.
What is the InChIKey of N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene?
The InChIKey is ITVJGWVSDDCUHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3.C6H8N2O2/c8-7(9,10)6-4-2-1-3-5-6;1-2-5(9)8-6-7-3-4-10-6/h1-5H;3-4H,2H2,1H3,(H,7,8,9).
What are the key properties of N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene?
N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene has a molecular weight of 286.25 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-oxazol-2-yl)propanamide;trifluoromethylbenzene is sourced from PubChem (CID 70489067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).