C13H11F3N2O2 — CID 70489070
4,4,4-trifluoro-N-(1,3-oxazol-2-yl)-3-phenylbutanamide (PubChem CID 70489070) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(1,3-oxazol-2-yl)-3-phenylbutanamide.
| Compound Name | 4,4,4-trifluoro-N-(1,3-oxazol-2-yl)-3-phenylbutanamide |
|---|---|
| PubChem CID | 70489070 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4,4,4-trifluoro-N-(1,3-oxazol-2-yl)-3-phenylbutanamide |
| SMILES | O=C(CC(c1ccccc1)C(F)(F)F)Nc1ncco1 |
| InChI | InChI=1S/C13H11F3N2O2/c14-13(15,16)10(9-4-2-1-3-5-9)8-11(19)18-12-17-6-7-20-12/h1-7,10H,8H2,(H,17,18,19) |
| InChIKey | YGKIKIVGXGLWJK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |