About (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one
(4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one (PubChem CID 70489191) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one.
Molecular Properties
| Compound Name | (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one |
| PubChem CID | 70489191 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one |
| SMILES | CC1CCC/C=C\C/C=C\CC(=O)O1 |
| InChI | InChI=1S/C12H18O2/c1-11-9-7-5-3-2-4-6-8-10-12(13)14-11/h2-3,6,8,11H,4-5,7,9-10H2,1H3/b3-2-,8-6- |
| InChIKey | FAMIQKMUIARKKU-RMFUBFLQSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one?
The IUPAC name of (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one (CID 70489191) is (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one.
What is the SMILES notation for (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one?
The canonical SMILES for (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one is CC1CCC/C=C\C/C=C\CC(=O)O1.
What is the InChIKey of (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one?
The InChIKey is FAMIQKMUIARKKU-RMFUBFLQSA-N. The full InChI is InChI=1S/C12H18O2/c1-11-9-7-5-3-2-4-6-8-10-12(13)14-11/h2-3,6,8,11H,4-5,7,9-10H2,1H3/b3-2-,8-6-.
What are the key properties of (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one?
(4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one has a molecular weight of 194.27 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,7Z)-12-methyl-1-oxacyclododeca-4,7-dien-2-one is sourced from PubChem (CID 70489191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).