C15H18ClN4O2S+ — CID 7048954
2-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-dimethylazanium (PubChem CID 7048954) has the molecular formula C15H18ClN4O2S+ and a molecular weight of 353.86 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-dimethylazanium.
| Compound Name | 2-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7048954 |
| Molecular Formula | C15H18ClN4O2S+ |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CC/N=C/C1C(=O)NC(=S)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C15H17ClN4O2S/c1-19(2)8-7-17-9-12-13(21)18-15(23)20(14(12)22)11-5-3-10(16)4-6-11/h3-6,9,12H,7-8H2,1-2H3,(H,18,21,23)/p+1/b17-9+ |
| InChIKey | GONSVLFPWUUHNO-RQZCQDPDSA-O |
| XLogP | -0.08 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|