C14H20N4O5S — CID 7048976
N-[(3S,8S,9aS)-3-methyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 7048976) has the molecular formula C14H20N4O5S and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[(3S,8S,9aS)-3-methyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[(3S,8S,9aS)-3-methyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 7048976 |
| Molecular Formula | C14H20N4O5S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[(3S,8S,9aS)-3-methyl-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N[C@H]1CCN2C(=O)[C@H](C)NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C14H20N4O5S/c1-7-12(9(3)23-16-7)24(21,22)17-10-4-5-18-11(6-10)13(19)15-8(2)14(18)20/h8,10-11,17H,4-6H2,1-3H3,(H,15,19)/t8-,10-,11-/m0/s1 |
| InChIKey | BAUPFWQUISJPIV-LSJOCFKGSA-N |
| XLogP | -0.55 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |