C29H41ClN2O2 — CID 70489849
N-benzylhexan-1-amine;9-ethyl-6-methyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione;hydrochloride (PubChem CID 70489849) has the molecular formula C29H41ClN2O2 and a molecular weight of 485.11 g/mol. Its IUPAC name is N-benzylhexan-1-amine;9-ethyl-6-methyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione;hydrochloride.
| Compound Name | N-benzylhexan-1-amine;9-ethyl-6-methyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione;hydrochloride |
|---|---|
| PubChem CID | 70489849 |
| Molecular Formula | C29H41ClN2O2 |
| Molecular Weight | 485.11 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | N-benzylhexan-1-amine;9-ethyl-6-methyl-1,2,4,7,8,9-hexahydrobenzo[f]quinoline-3,10-dione;hydrochloride |
| SMILES | CCC1CCc2c(C)cc3c(c2C1=O)CCC(=O)N3.CCCCCCNCc1ccccc1.Cl |
| InChI | InChI=1S/C16H19NO2.C13H21N.ClH/c1-3-10-4-5-11-9(2)8-13-12(15(11)16(10)19)6-7-14(18)17-13;1-2-3-4-8-11-14-12-13-9-6-5-7-10-13;/h8,10H,3-7H2,1-2H3,(H,17,18);5-7,9-10,14H,2-4,8,11-12H2,1H3;1H |
| InChIKey | APBSWDWVPCPXQD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.11 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|