C21H27NO2 — CID 70490212
5-ethyl-3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene (PubChem CID 70490212) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 5-ethyl-3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene.
| Compound Name | 5-ethyl-3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene |
|---|---|
| PubChem CID | 70490212 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 5-ethyl-3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),9,11,14(18)-pentaene |
| SMILES | CCC1CC2=C(C3=C(OC)NCC4=C3C(=CC2)C=CC4)C(OC)C1 |
| InChI | InChI=1S/C21H27NO2/c1-4-13-10-15-9-8-14-6-5-7-16-12-22-21(24-3)20(18(14)16)19(15)17(11-13)23-2/h5-6,8,13,17,22H,4,7,9-12H2,1-3H3 |
| InChIKey | FXASABBDSBWTNT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |