C21H25NO2 — CID 70490622
5-ethyl-3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,9,11,14(18)-hexaene (PubChem CID 70490622) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 5-ethyl-3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,9,11,14(18)-hexaene.
| Compound Name | 5-ethyl-3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,9,11,14(18)-hexaene |
|---|---|
| PubChem CID | 70490622 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 5-ethyl-3,17-dimethoxy-16-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2(7),3,9,11,14(18)-hexaene |
| SMILES | CCC1C=C(OC)C2=C(CC=C3C=CCC4=C3C2=C(OC)NC4)C1 |
| InChI | InChI=1S/C21H25NO2/c1-4-13-10-15-9-8-14-6-5-7-16-12-22-21(24-3)20(18(14)16)19(15)17(11-13)23-2/h5-6,8,11,13,22H,4,7,9-10,12H2,1-3H3 |
| InChIKey | DAOOJHBOZJNUMS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |